20280-81-3 4-Methoxycoumarin
| Nome del prodotto |
4-Methoxycoumarin |
| Nome inglese |
4-Methoxycoumarin;4-Methoxycourmarin; 2H-1-Benzopyran-2-one, 4-methoxy-; 4-methoxy-2H-chromen-2-one |
| Formula molecolare |
C10H8O3 |
| Peso Molecolare |
176.1687 |
| InChI |
InChI=1/C10H8O3/c1-12-9-6-10(11)13-8-5-3-2-4-7(8)9/h2-6H,1H3 |
| Numero CAS |
20280-81-3 |
| Struttura molecolare |
|
| Densità |
1.26g/cm3 |
| Punto di ebollizione |
347.8°C at 760 mmHg |
| Indice di rifrazione |
1.581 |
| Punto d'infiammabilità |
144.5°C |
| Pressione di vapore |
5.27E-05mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|