20280-81-3 4-Methoxycoumarin
| Produkt-Name |
4-Methoxycoumarin |
| Englischer Name |
4-Methoxycoumarin;4-Methoxycourmarin; 2H-1-Benzopyran-2-one, 4-methoxy-; 4-methoxy-2H-chromen-2-one |
| Molekulare Formel |
C10H8O3 |
| Molecular Weight |
176.1687 |
| InChI |
InChI=1/C10H8O3/c1-12-9-6-10(11)13-8-5-3-2-4-7(8)9/h2-6H,1H3 |
| CAS Registry Number |
20280-81-3 |
| Molecular Structure |
|
| Dichte |
1.26g/cm3 |
| Siedepunkt |
347.8°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
144.5°C |
| Dampfdruck |
5.27E-05mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|