ChemNet > CAS > 19819-95-5 2-Chlorophenethylalcohol
19819-95-5 2-Chlorophenethylalcohol
| Nome del prodotto |
2-Chlorophenethylalcohol |
| Nome inglese |
2-Chlorophenethylalcohol; 2-(2-Chlorophenyl)ethanol |
| Formula molecolare |
C8H9ClO |
| Peso Molecolare |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| Numero CAS |
19819-95-5 |
| EINECS |
243-348-0 |
| Struttura molecolare |
|
| Densità |
1.189g/cm3 |
| Punto di ebollizione |
227.5°C at 760 mmHg |
| Indice di rifrazione |
1.554 |
| Punto d'infiammabilità |
101.1°C |
| Pressione di vapore |
0.0435mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|