ChemNet > CAS > 19819-95-5 2-Chlorophenethylalcohol
19819-95-5 2-Chlorophenethylalcohol
| product Name |
2-Chlorophenethylalcohol |
| CAS No |
19819-95-5 |
| Synonyms |
2-(2-Chlorophenyl)ethanol |
| Molecular Formula |
C8H9ClO |
| Molecular Weight |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| EINECS |
243-348-0 |
| Molecular Structure |
|
| Density |
1.189g/cm3 |
| Boiling point |
227.5°C at 760 mmHg |
| Refractive index |
1.554 |
| Flash point |
101.1°C |
| Vapour Pressur |
0.0435mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|