ChemNet > CAS > 180-84-7 1,7-Dioxaspiro(5.5)undecane
180-84-7 1,7-Dioxaspiro(5.5)undecane
| Nome del prodotto |
1,7-Dioxaspiro(5.5)undecane |
| Nome inglese |
1,7-Dioxaspiro(5.5)undecane; Dioxaspiroundecane |
| Formula molecolare |
C9H16O2 |
| Peso Molecolare |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-7-10-9(5-1)6-2-4-8-11-9/h1-8H2 |
| Numero CAS |
180-84-7 |
| EINECS |
205-870-7 |
| Struttura molecolare |
|
| Densità |
1.02g/cm3 |
| Punto di ebollizione |
193.5°C at 760 mmHg |
| Indice di rifrazione |
1.475 |
| Punto d'infiammabilità |
63.9°C |
| Pressione di vapore |
0.645mmHg at 25°C |
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|