ChemNet > CAS > 180-84-7 1,7-Dioxaspiro(5.5)undecane
180-84-7 1,7-Dioxaspiro(5.5)undecane
| product Name |
1,7-Dioxaspiro(5.5)undecane |
| CAS No |
180-84-7 |
| Synonyms |
Dioxaspiroundecane |
| Molecular Formula |
C9H16O2 |
| Molecular Weight |
156.2221 |
| InChI |
InChI=1/C9H16O2/c1-3-7-10-9(5-1)6-2-4-8-11-9/h1-8H2 |
| EINECS |
205-870-7 |
| Molecular Structure |
|
| Density |
1.02g/cm3 |
| Boiling point |
193.5°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
63.9°C |
| Vapour Pressur |
0.645mmHg at 25°C |
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|