16881-77-9 methyldimethoxysilane
| Nome del prodotto |
methyldimethoxysilane |
| Nome inglese |
methyldimethoxysilane; Dimethoxymethylsilane; dimethoxy(methyl)silyl |
| Formula molecolare |
C3H10O2Si |
| Peso Molecolare |
106.1958 |
| InChI |
InChI=1/C3H10O2Si/c1-4-3(6)5-2/h3H,1-2,6H3 |
| Numero CAS |
16881-77-9 |
| EINECS |
240-914-9 |
| Struttura molecolare |
|
| Punto di ebollizione |
75.417°C at 760 mmHg |
| Punto d'infiammabilità |
-0.587°C |
| Pressione di vapore |
115.438mmHg at 25°C |
| Codici di Rischio |
R11:Highly flammable.;
R37/38:Irritating to respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| Sicurezza Descrizione |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|