16881-77-9 methyldimethoxysilane
| Produkt-Name |
methyldimethoxysilane |
| Englischer Name |
methyldimethoxysilane; Dimethoxymethylsilane; dimethoxy(methyl)silyl |
| Molekulare Formel |
C3H10O2Si |
| Molecular Weight |
106.1958 |
| InChI |
InChI=1/C3H10O2Si/c1-4-3(6)5-2/h3H,1-2,6H3 |
| CAS Registry Number |
16881-77-9 |
| EINECS |
240-914-9 |
| Molecular Structure |
|
| Siedepunkt |
75.417°C at 760 mmHg |
| Flammpunkt |
-0.587°C |
| Dampfdruck |
115.438mmHg at 25°C |
| Risk Codes |
R11:Highly flammable.;
R37/38:Irritating to respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| Safety Beschreibung |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|