5781-53-3 Methyl oxalyl chloride
| ??? ????? |
Methyl oxalyl chloride |
| ??? ??????? |
Methyl oxalyl chloride; Methyl chloroglyoxylate; Monomethyl oxalyl chloride; methyl chlorooxoacetate; Chloroglyoxylic acid methyl ester |
| ????? ???????? |
C3H3ClO3 |
| ??? ??????? |
122.5071 |
| InChI |
InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
| ????? ?????? |
5781-53-3 |
| ????? ??????? ??????? |
227-307-4 |
| ?????? ??????? |
|
| ????? |
1.36g/cm3 |
| ???? ????? |
119°C at 760 mmHg |
| ???? ???? |
1.416 |
| ???? ?????? |
46.7°C |
| ???? ???? |
16.3mmHg at 25°C |
| ??? ?????? |
C:Corrosive;
|
| ????? ??? |
R10:Flammable.;
R34:Causes burns.;
|
| ??????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S28A:After contact with skin, wash immediately with plenty of water.;
S9:Keep container in a well-ventilated place.;
|
|