5781-53-3 Methyl oxalyl chloride
| ?? ????? |
Methyl oxalyl chloride |
| ?? ????? |
Methyl oxalyl chloride; Methyl chloroglyoxylate; Monomethyl oxalyl chloride; methyl chlorooxoacetate; Chloroglyoxylic acid methyl ester |
| ????????? ??????? |
C3H3ClO3 |
| ???? ???????? |
122.5071 |
| InChI |
InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
| ???? CAS |
5781-53-3 |
| EINECS |
227-307-4 |
| ???? ???????? |
|
| ?????? |
1.36g/cm3 |
| ????? ????? |
119°C at 760 mmHg |
| ???? ????? |
1.416 |
| ????? ???? |
46.7°C |
| ??? ???? |
16.3mmHg at 25°C |
| Hazard ?????? |
C:Corrosive;
|
| ??????? ???? |
R10:Flammable.;
R34:Causes burns.;
|
| ?????? ????? |
S16:Keep away from sources of ignition - No smoking.;
S28A:After contact with skin, wash immediately with plenty of water.;
S9:Keep container in a well-ventilated place.;
|
|