ChemNet > CAS > 52178-50-4 methyl 3-formylbenzoate
52178-50-4 methyl 3-formylbenzoate
| ??? ????? |
methyl 3-formylbenzoate |
| ??? ??????? |
methyl 3-formylbenzoate; Methyl benzaldehyde-4-carboxylate |
| ????? ???????? |
C9H8O3 |
| ??? ??????? |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
| ????? ?????? |
52178-50-4 |
| ?????? ??????? |
|
| ????? |
1.181g/cm3 |
| ???? ??? |
48-55℃ |
| ???? ????? |
272.8°C at 760 mmHg |
| ???? ???? |
1.557 |
| ???? ?????? |
118.2°C |
| ???? ???? |
0.00596mmHg at 25°C |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|