ChemNet > CAS > 52178-50-4 methyl 3-formylbenzoate
52178-50-4 methyl 3-formylbenzoate
| product Name |
methyl 3-formylbenzoate |
| CAS No |
52178-50-4 |
| Synonyms |
Methyl benzaldehyde-4-carboxylate |
| Molecular Formula |
C9H8O3 |
| Molecular Weight |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
| Molecular Structure |
|
| Density |
1.181g/cm3 |
| Melting point |
48-55℃ |
| Boiling point |
272.8°C at 760 mmHg |
| Refractive index |
1.557 |
| Flash point |
118.2°C |
| Vapour Pressur |
0.00596mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Manager Liu |
| Email |
yf79009@163.com |
| Address |
East Zone, Huazhong Shimao Wanhuo City, Longhu Town, Xinzheng City, Zhengzhou City, Henan Province, China |