ChemNet > CAS > 2059-76-9 4-iodophenyl isothiocyanate
2059-76-9 4-iodophenyl isothiocyanate
| ??? ????? |
4-iodophenyl isothiocyanate |
| ??? ??????? |
4-iodophenyl isothiocyanate; 4-Iodoisothiocyanatobenzene; 1-iodo-4-isothiocyanatobenzene |
| ????? ???????? |
C7H4INS |
| ??? ??????? |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| ????? ?????? |
2059-76-9 |
| ?????? ??????? |
|
| ????? |
1.76g/cm3 |
| ???? ??? |
70-76℃ |
| ???? ????? |
299.5°C at 760 mmHg |
| ???? ???? |
1.672 |
| ???? ?????? |
134.9°C |
| ???? ???? |
0.00212mmHg at 25°C |
| ??? ?????? |
Xn:Harmful;
|
| ????? ??? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|