ChemNet > CAS > 2059-76-9 4-iodophenyl isothiocyanate
2059-76-9 4-iodophenyl isothiocyanate
| Produkt-Name |
4-iodophenyl isothiocyanate |
| Englischer Name |
4-iodophenyl isothiocyanate; 4-Iodoisothiocyanatobenzene; 1-iodo-4-isothiocyanatobenzene |
| Molekulare Formel |
C7H4INS |
| Molecular Weight |
261.0828 |
| InChI |
InChI=1/C7H4INS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| CAS Registry Number |
2059-76-9 |
| Molecular Structure |
|
| Dichte |
1.76g/cm3 |
| Schmelzpunkt |
70-76℃ |
| Siedepunkt |
299.5°C at 760 mmHg |
| Brechungsindex |
1.672 |
| Flammpunkt |
134.9°C |
| Dampfdruck |
0.00212mmHg at 25°C |
| Gefahrensymbole |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|