ChemNet > CAS > 1878-49-5 (2-Methylphenoxy)acetic acid
1878-49-5 (2-Methylphenoxy)acetic acid
| ??? ????? |
(2-Methylphenoxy)acetic acid |
| ??? ??????? |
(2-Methylphenoxy)acetic acid; 2-Methylphenoxyacetic acid; (o-Tolyloxy)-acetic acid; (2-methylphenoxy)acetate |
| ????? ???????? |
C9H9O3 |
| ??? ??????? |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-7-4-2-3-5-8(7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| ????? ?????? |
1878-49-5 |
| ????? ??????? ??????? |
217-517-4 |
| ?????? ??????? |
|
| ???? ??? |
152-154℃ |
| ???? ????? |
288.4°C at 760 mmHg |
| ???? ?????? |
115.7°C |
| ???? ???? |
0.00109mmHg at 25°C |
| ??? ?????? |
Xi:Irritant;
|
| ????? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|