ChemNet > CAS > 1878-49-5 (2-Methylphenoxy)acetic acid
1878-49-5 (2-Methylphenoxy)acetic acid
| product Name |
(2-Methylphenoxy)acetic acid |
| CAS No |
1878-49-5 |
| Synonyms |
2-Methylphenoxyacetic acid; (o-Tolyloxy)-acetic acid; (2-methylphenoxy)acetate |
| Molecular Formula |
C9H9O3 |
| Molecular Weight |
165.1665 |
| InChI |
InChI=1/C9H10O3/c1-7-4-2-3-5-8(7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| EINECS |
217-517-4 |
| Molecular Structure |
|
| Melting point |
152-154℃ |
| Boiling point |
288.4°C at 760 mmHg |
| Flash point |
115.7°C |
| Vapour Pressur |
0.00109mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|