ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
| ?????? ?? ??? |
3,3'-difluorobenzophenone |
| ???????? ??? |
3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
| ????? ???????? |
C13H8F2O |
| ?????? ??? |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
| ??? ??????? ?????? |
345-70-0 |
| ????? ?????? |
|
| ????? |
1.239g/cm3 |
| ?????? |
56-59℃ |
| ????? ?? ??? |
316.2°C at 760 mmHg |
| ??????? ??????? |
1.549 |
| ????? ??????? |
121.3°C |
| ????? ?? ???? |
0.000415mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|