ChemNet > CAS > 345-70-0 3,3'-difluorobenzophenone
345-70-0 3,3'-difluorobenzophenone
| Ονομασ?α του προ??ντο? |
3,3'-difluorobenzophenone |
| Αγγλικ? ?νομα |
3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
| MF |
C13H8F2O |
| Μοριακ? β?ρο? |
218.1988 |
| InChI |
InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
| CAS ΟΧΙ |
345-70-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.239g/cm3 |
| Σημε?ο τ?ξη? |
56-59℃ |
| Σημε?ο βρασμο? |
316.2°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.549 |
| Σημε?ο αν?φλεξη? |
121.3°C |
| Π?εση ατμ?ν |
0.000415mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|