ChemNet > CAS > 1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
| ?????? ?? ??? |
2-Bromo-2',5'-dimethoxyacetophenone |
| ???????? ??? |
2-Bromo-2',5'-dimethoxyacetophenone; bromomethyl 2,5-dimethoxyphenyl ketone; 2-Bromo-2,5-dimethoxyacetophenone; 2-bromo-1-(2,5-dimethoxyphenyl)ethanone |
| ????? ???????? |
C10H11BrO3 |
| ?????? ??? |
259.0965 |
| InChI |
InChI=1/C10H11BrO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5H,6H2,1-2H3 |
| ??? ??????? ?????? |
1204-21-3 |
| EINECS |
214-873-2 |
| ????? ?????? |
|
| ????? |
1.422g/cm3 |
| ?????? |
83-88℃ |
| ????? ?? ??? |
323.1°C at 760 mmHg |
| ??????? ??????? |
1.542 |
| ????? ??????? |
149.2°C |
| ????? ?? ???? |
0.000268mmHg at 25°C |
| ???? ?????? |
Xi:Irritant;
|
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|