ChemNet > CAS > 1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
1204-21-3 2-Bromo-2',5'-dimethoxyacetophenone
| product Name |
2-Bromo-2',5'-dimethoxyacetophenone |
| CAS No |
1204-21-3 |
| Synonyms |
bromomethyl 2,5-dimethoxyphenyl ketone; 2-Bromo-2,5-dimethoxyacetophenone; 2-bromo-1-(2,5-dimethoxyphenyl)ethanone |
| Molecular Formula |
C10H11BrO3 |
| Molecular Weight |
259.0965 |
| InChI |
InChI=1/C10H11BrO3/c1-13-7-3-4-10(14-2)8(5-7)9(12)6-11/h3-5H,6H2,1-2H3 |
| EINECS |
214-873-2 |
| Molecular Structure |
|
| Density |
1.422g/cm3 |
| Melting point |
83-88℃ |
| Boiling point |
323.1°C at 760 mmHg |
| Refractive index |
1.542 |
| Flash point |
149.2°C |
| Vapour Pressur |
0.000268mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-21-61066956/57/58??61043548 |
| Email |
sales@domen.com.cn |
| Address |
Rm1907, Bldg A, No.1088 Xinjinqiao Rd, Pudong, Shanghai, China |
| Contact |
Sergei Gresko |
| Telephone |
+380623854830 |
| Email |
sales@intermedchemicals.com |
| Address |
17-a Bakinsky Kommissarov Str. 83049 Donetsk UKRAINE |