1186-52-3 Acetic-d3 acid-d
| ?????? ?? ??? |
Acetic-d3 acid-d |
| ???????? ??? |
Acetic-d3 acid-d; Acetic Acid-d4 |
| ????? ???????? |
C2D4O2 |
| ?????? ??? |
64.0766 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| ??? ??????? ?????? |
1186-52-3 |
| EINECS |
214-693-4 |
| ????? ?????? |
|
| ????? |
1.14g/cm3 |
| ?????? |
15-16℃ |
| ????? ?? ??? |
117.1°C at 760 mmHg |
| ??????? ??????? |
1.375 |
| ????? ??????? |
40°C |
| ????? ?? ???? |
13.9mmHg at 25°C |
| ???? ?????? |
C:Corrosive;
|
| ???? ?? ??? |
R10:Flammable.;
R35:Causes severe burns.;
|
| ??????? ????? |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|