1186-52-3 Acetic-d3 acid-d
| product Name |
Acetic-d3 acid-d |
| CAS No |
1186-52-3 |
| Synonyms |
Acetic Acid-d4 |
| Molecular Formula |
C2D4O2 |
| Molecular Weight |
64.0766 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i1D3/hD |
| EINECS |
214-693-4 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Melting point |
15-16℃ |
| Boiling point |
117.1°C at 760 mmHg |
| Refractive index |
1.375 |
| Flash point |
40°C |
| Vapour Pressur |
13.9mmHg at 25°C |
| Hazard Symbols |
C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R35:Causes severe burns.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr. Chen |
| Telephone |
+86-15900983188 |
| Email |
chen@chenchem.com |
| Address |
13# 16299Lane, Puwei Road, Shanyang, Jinshan Shanghai, China; Hangzhou Office:Hall 102, No. 333 Wensan West Road, Xihu District, Hangzhou City, Zhejiang, China |