13861-22-8 Propargyl methacrylate
| ?? ????? |
Propargyl methacrylate |
| ?? ????? |
Propargyl methacrylate; Methacrylic acid propargyl ester~2-Propyn-1-yl 2-methylpropenoate; prop-2-yn-1-yl 2-methylprop-2-enoate |
| ????????? ??????? |
C7H8O2 |
| ???? ???????? |
124.1372 |
| InChI |
InChI=1/C7H8O2/c1-4-5-9-7(8)6(2)3/h1H,2,5H2,3H3 |
| ???? CAS |
13861-22-8 |
| EINECS |
237-599-5 |
| ???? ???????? |
|
| ?????? |
0.983g/cm3 |
| ????? ????? |
148.4°C at 760 mmHg |
| ???? ????? |
1.445 |
| ????? ???? |
43.2°C |
| ??? ???? |
4.23mmHg at 25°C |
| ??????? ???? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|