13861-22-8 Propargyl methacrylate
| Produkt-Name |
Propargyl methacrylate |
| Englischer Name |
Propargyl methacrylate; Methacrylic acid propargyl ester~2-Propyn-1-yl 2-methylpropenoate; prop-2-yn-1-yl 2-methylprop-2-enoate |
| Molekulare Formel |
C7H8O2 |
| Molecular Weight |
124.1372 |
| InChI |
InChI=1/C7H8O2/c1-4-5-9-7(8)6(2)3/h1H,2,5H2,3H3 |
| CAS Registry Number |
13861-22-8 |
| EINECS |
237-599-5 |
| Molecular Structure |
|
| Dichte |
0.983g/cm3 |
| Siedepunkt |
148.4°C at 760 mmHg |
| Brechungsindex |
1.445 |
| Flammpunkt |
43.2°C |
| Dampfdruck |
4.23mmHg at 25°C |
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|