1135-12-2 4-Aminodiphenylmethane
| Nama produk |
4-Aminodiphenylmethane |
| Nama bahasa Inggris |
4-Aminodiphenylmethane; 4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
| MF |
C13H13N |
| Berat Molekul |
183.249 |
| InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| CAS NO |
1135-12-2 |
| Struktur Molekul |
|
| Kepadatan |
1.07g/cm3 |
| Titik didih |
300°C at 760 mmHg |
| Indeks bias |
1.616 |
| Titik nyala |
159.5°C |
| Tekanan uap |
0.00115mmHg at 25°C |
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|