1135-12-2 4-Aminodiphenylmethane
| Ονομασ?α του προ??ντο? |
4-Aminodiphenylmethane |
| Αγγλικ? ?νομα |
4-Aminodiphenylmethane; 4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
| MF |
C13H13N |
| Μοριακ? β?ρο? |
183.249 |
| InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| CAS ΟΧΙ |
1135-12-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.07g/cm3 |
| Σημε?ο βρασμο? |
300°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.616 |
| Σημε?ο αν?φλεξη? |
159.5°C |
| Π?εση ατμ?ν |
0.00115mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|