24800-44-0 Tripropylene glycol
| termék neve |
Tripropylene glycol |
| Angol név |
Tripropylene glycol; Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
| MF |
C9H20O4 |
| Molekulat?meg |
192.2527 |
| InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
| CAS-szám |
24800-44-0 |
| EINECS |
246-466-0 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.038g/cm3 |
| Forráspont |
316.1°C at 760 mmHg |
| T?résmutató |
1.455 |
| Gyulladáspont |
145°C |
| G?znyomás |
3.54E-05mmHg at 25°C |
|