24800-44-0 Tripropylene glycol
| Nom |
Tripropylene glycol |
| Nom anglais |
Tripropylene glycol; Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
| Formule moléculaire |
C9H20O4 |
| Poids Moléculaire |
192.2527 |
| InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
| Numéro de registre CAS |
24800-44-0 |
| EINECS |
246-466-0 |
| Structure moléculaire |
|
| Densité |
1.038g/cm3 |
| Point d'ébullition |
316.1°C at 760 mmHg |
| Indice de réfraction |
1.455 |
| Point d'éclair |
145°C |
| Pression de vapeur |
3.54E-05mmHg at 25°C |
|