1119-46-6 5-Chlorovaleric acid
| termék neve |
5-Chlorovaleric acid |
| Angol név |
5-Chlorovaleric acid; 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| MF |
C5H9ClO2 |
| Molekulat?meg |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| CAS-szám |
1119-46-6 |
| EINECS |
214-279-3 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.166g/cm3 |
| Olvadáspont |
18-20℃ |
| Forráspont |
230.9°C at 760 mmHg |
| T?résmutató |
1.452 |
| Gyulladáspont |
93.4°C |
| G?znyomás |
0.0227mmHg at 25°C |
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|