1119-46-6 5-Chlorovaleric acid
| product Name |
5-Chlorovaleric acid |
| CAS No |
1119-46-6 |
| Synonyms |
214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| Molecular Formula |
C5H9ClO2 |
| Molecular Weight |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| EINECS |
214-279-3 |
| Molecular Structure |
|
| Density |
1.166g/cm3 |
| Melting point |
18-20℃ |
| Boiling point |
230.9°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
93.4°C |
| Vapour Pressur |
0.0227mmHg at 25°C |
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
Featured China Suppliers
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |
| Contact |
Ma Jianye |
| Telephone |
+86-513-84816988 |
| Email |
mjy@jszychem.com |
| Address |
Haibinsi Road, Yangkou Chemical Industrial Park, Rudong Country, Jiangsu Province, China. |
| Specifications |
99% |
| Description |
CAS??1119-46-6 Name:5-chlorovaleric acid Purity:99% Appearance:light yellow crystal powder or liquid Application:Apixaban intermediates |
| Contact |
Mr.Xu |
| Telephone |
0714-6395977/0714-6395877/0714-6395933 |
| Email |
info@lansunpharma.com |
| Address |
No.81# Pengcheng Avenue Road, economic & technical development area |
| Contact |
Su Guangming |
| Telephone |
+86-537-8018166;18061500111 |
| Email |
suguangming@126.com |
| Address |
Jining Chemical Industrial Development Zone, Jinxiang County, Shandong, China |