58971-11-2 3-Bromophenethylamine
| Ονομασ?α του προ??ντο? |
3-Bromophenethylamine |
| Αγγλικ? ?νομα |
3-Bromophenethylamine;2-(3-bromophenyl)ethanaminium; 2-(3-bromophenyl)ethanamine; 3-Bromo-benzeneethanamine |
| MF |
C8H10BrN |
| Μοριακ? β?ρο? |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
| CAS ΟΧΙ |
58971-11-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.407g/cm3 |
| Σημε?ο βρασμο? |
263.4°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.575 |
| Σημε?ο αν?φλεξη? |
113.1°C |
| Π?εση ατμ?ν |
0.0103mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
C:Corrosive;
|
| Κινδ?νου Κ?δικε? |
R34:Causes burns.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|