58971-11-2 3-Bromophenethylamine
| název vyrobku |
3-Bromophenethylamine |
| Anglicky název |
3-Bromophenethylamine;2-(3-bromophenyl)ethanaminium; 2-(3-bromophenyl)ethanamine; 3-Bromo-benzeneethanamine |
| Molekulární vzorec |
C8H10BrN |
| Molekulová hmotnost |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
| Registra?ní ?íslo CAS |
58971-11-2 |
| Molekulární struktura |
|
| Hustota |
1.407g/cm3 |
| Bod varu |
263.4°C at 760 mmHg |
| Index lomu |
1.575 |
| Bod vzplanutí |
113.1°C |
| Tlak par |
0.0103mmHg at 25°C |
| Symbol? nebezpe?nosti |
C:Corrosive;
|
| Riziko Codes |
R34:Causes burns.;
|
| Bezpe?nostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|