135-00-2 2-Benzoylthiophene
| Ονομασ?α του προ??ντο? |
2-Benzoylthiophene |
| Αγγλικ? ?νομα |
2-Benzoylthiophene; 2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
| MF |
C11H8OS |
| Μοριακ? β?ρο? |
188.2456 |
| InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| CAS ΟΧΙ |
135-00-2 |
| EINECS |
205-169-6 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.198g/cm3 |
| Σημε?ο βρασμο? |
300°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.609 |
| Σημε?ο αν?φλεξη? |
139.7°C |
| Π?εση ατμ?ν |
0.00115mmHg at 25°C |
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|