135-00-2 2-Benzoylthiophene
| Nom |
2-Benzoylthiophene |
| Nom anglais |
2-Benzoylthiophene; 2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
| Formule moléculaire |
C11H8OS |
| Poids Moléculaire |
188.2456 |
| InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| Numéro de registre CAS |
135-00-2 |
| EINECS |
205-169-6 |
| Structure moléculaire |
|
| Densité |
1.198g/cm3 |
| Point d'ébullition |
300°C at 760 mmHg |
| Indice de réfraction |
1.609 |
| Point d'éclair |
139.7°C |
| Pression de vapeur |
0.00115mmHg at 25°C |
| Description de sécurité |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|