3019-20-3 Isopropylthiobenzene
| Nom |
Isopropylthiobenzene |
| Nom anglais |
Isopropylthiobenzene; (Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
| Formule moléculaire |
C9H12S |
| Poids Moléculaire |
152.2566 |
| InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| Numéro de registre CAS |
3019-20-3 |
| EINECS |
221-162-0 |
| Structure moléculaire |
|
| Densité |
0.98g/cm3 |
| Point d'ébullition |
208°C at 760 mmHg |
| Indice de réfraction |
1.544 |
| Point d'éclair |
83.2°C |
| Pression de vapeur |
0.315mmHg at 25°C |
| Description de sécurité |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|