3019-20-3 Isopropylthiobenzene
| product Name |
Isopropylthiobenzene |
| CAS No |
3019-20-3 |
| Synonyms |
(Isopropylthio)benzene; Isopropyl phenyl sulphide; (propan-2-ylsulfanyl)benzene |
| Molecular Formula |
C9H12S |
| Molecular Weight |
152.2566 |
| InChI |
InChI=1/C9H12S/c1-8(2)10-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| EINECS |
221-162-0 |
| Molecular Structure |
|
| Density |
0.98g/cm3 |
| Boiling point |
208°C at 760 mmHg |
| Refractive index |
1.544 |
| Flash point |
83.2°C |
| Vapour Pressur |
0.315mmHg at 25°C |
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|