925-60-0 n-Propyl acrylate
| ürün Ad? |
n-Propyl acrylate |
| ingilizce ad? |
n-Propyl acrylate; n-Propyl acrylate, (Acrylic acid n-propyl ester); Acrylic acid n-propyl ester; Propyl acrylate |
| Moleküler Formülü |
C6H10O2 |
| Molekül A??rl??? |
114.14 |
| InChI |
InChI=1/C6H10O2/c1-3-5-8-6(7)4-2/h4H,2-3,5H2,1H3 |
| CAS kay?t numaras? |
925-60-0 |
| EINECS |
213-120-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
43 |
| Kaynama noktas? |
43℃ (40 torr) |
| Risk Kodlar? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|