| ürün Ad? |
D-chiro-Inositol |
| ingilizce ad? |
D-chiro-Inositol; 1D-chiro-inositol; (1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol |
| Moleküler Formülü |
C6H12O6 |
| Molekül A??rl??? |
180.1559 |
| InChI |
InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1 |
| CAS kay?t numaras? |
643-12-9 |
| EINECS |
211-394-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
2.039g/cm3 |
| Ergime noktas? |
230℃ |
| Kaynama noktas? |
291.326°C at 760 mmHg |
| K?r?lma indisi |
1.784 |
| Alevlenme noktas? |
143.387°C |
| Buhar bas?nc? |
0mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|