ChemNet > CAS > 392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
392-04-1 Methyl 4-fluoro-2-hydroxybenzoate
| ürün Ad? |
Methyl 4-fluoro-2-hydroxybenzoate |
| ingilizce ad? |
Methyl 4-fluoro-2-hydroxybenzoate; Methyl 4-fluorosalicylate; 4-Fluorosalicylic acid methyl ester; Methyl 4-fluoro-2-hydroxybenzoate; 4-Fluoro-6-hydroxy-benzoic acid methyl ester |
| Moleküler Formülü |
C8H7FO3 |
| Molekül A??rl??? |
170.1378 |
| InChI |
InChI=1/C8H7FO3/c1-12-8(11)6-3-2-5(9)4-7(6)10/h2-4,10H,1H3 |
| CAS kay?t numaras? |
392-04-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.309g/cm3 |
| Kaynama noktas? |
224.7°C at 760 mmHg |
| K?r?lma indisi |
1.526 |
| Alevlenme noktas? |
89.7°C |
| Buhar bas?nc? |
0.0603mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|