ChemNet > CAS > 3327-22-8 (3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S.
3327-22-8 (3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S.
| ürün Ad? |
(3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S. |
| ingilizce ad? |
(3-chloro-2-hydroxypropyl)trimethyl-ammonium chloride S.; (3-Chloro-2-hydroxypropyl)trimethylammonium chloride; 3-chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride; 3-chloro-2-hydroxy-N,N,N-trimethylpropan-1-aminium; 1-amino-3-chloropropan-2-ol hydrochloride (1:1); 3-Chloro-2-hydroxypropyltrimethyl ammonium chloride |
| Moleküler Formülü |
C3H9Cl2NO |
| Molekül A??rl??? |
146.0157 |
| InChI |
InChI=1/C3H8ClNO.ClH/c4-1-3(6)2-5;/h3,6H,1-2,5H2;1H |
| CAS kay?t numaras? |
3327-22-8 |
| EINECS |
222-048-3 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
191-193℃ |
| Kaynama noktas? |
240.2°C at 760 mmHg |
| Alevlenme noktas? |
99.1°C |
| Buhar bas?nc? |
0.0067mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|