ChemNet > CAS > 24937-78-8 Ethylene/vinyl acetate copolymer
24937-78-8 Ethylene/vinyl acetate copolymer
| ürün Ad? |
Ethylene/vinyl acetate copolymer |
| ingilizce ad? |
Ethylene/vinyl acetate copolymer; Poly(ethylene-co-vinyl acetate); Acetic Acid Ethenyl Ester, Polymer with Ethene; Ethylene-vinyl acetate copolymer; Ethylene/vinyl acetate copolymer, 14% vinyl acetate; Ethylene-vinyl acetate copolymer resin; Ethylene-vinyl acetate latex; Ethylene-vinyl acetate molding resin; eva; Ethylene Vinyl Acetate; but-3-enoic acid-ethene (1:1); VAE; VAP; Ethylenelvinyl Acetate Copolymer |
| Moleküler Formülü |
C6H10O2 |
| Molekül A??rl??? |
114.1424 |
| InChI |
InChI=1/C4H6O2.C2H4/c1-2-3-4(5)6;1-2/h2H,1,3H2,(H,5,6);1-2H2 |
| CAS kay?t numaras? |
24937-78-8 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
99℃ |
| Kaynama noktas? |
170.6°C at 760 mmHg |
| Alevlenme noktas? |
68.2°C |
| Buhar bas?nc? |
0.714mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|