2436-96-6 2,2'-Dinitrobiphenyl
| ürün Ad? |
2,2'-Dinitrobiphenyl |
| ingilizce ad? |
2,2'-Dinitrobiphenyl;2,2'-Dinitrobiphenyl, 2,2'-dinitro-; NSC 13356; 1,1'-Biphenyl, 2,2'-dinitro- (9CI); Biphenyl, 2,2'-dinitro- (8CI) |
| Moleküler Formülü |
C12H8N2O4 |
| Molekül A??rl??? |
244.2029 |
| InChI |
InChI=1/C12H8N2O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H |
| CAS kay?t numaras? |
2436-96-6 |
| EINECS |
219-435-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.368g/cm3 |
| Ergime noktas? |
123-128℃ |
| Kaynama noktas? |
387.6°C at 760 mmHg |
| K?r?lma indisi |
1.635 |
| Alevlenme noktas? |
187.9°C |
| Buhar bas?nc? |
7.25E-06mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|