ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
| ürün Ad? |
3-Cyclohexene-1,1-dimethanol |
| ingilizce ad? |
3-Cyclohexene-1,1-dimethanol; 4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
| Moleküler Formülü |
C8H14O2 |
| Molekül A??rl??? |
142.1956 |
| InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
| CAS kay?t numaras? |
2160-94-3 |
| EINECS |
218-481-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.05g/cm3 |
| Ergime noktas? |
88-92℃ |
| Kaynama noktas? |
231.2°C at 760 mmHg |
| K?r?lma indisi |
1.497 |
| Alevlenme noktas? |
105°C |
| Buhar bas?nc? |
0.0119mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|