2096-86-8 4-Methylphenylacetone
| ürün Ad? |
4-Methylphenylacetone |
| ingilizce ad? |
4-Methylphenylacetone; 1-(4-methylphenyl)propan-2-one |
| Moleküler Formülü |
C10H12O |
| Molekül A??rl??? |
148.2017 |
| InChI |
InChI=1/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
| CAS kay?t numaras? |
2096-86-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.974g/cm3 |
| Kaynama noktas? |
223.1°C at 760 mmHg |
| K?r?lma indisi |
1.507 |
| Alevlenme noktas? |
97.1°C |
| Buhar bas?nc? |
0.0982mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|