ChemNet > CAS > 1985-12-2 4-Bromophenyl isothiocyanate
1985-12-2 4-Bromophenyl isothiocyanate
| ürün Ad? |
4-Bromophenyl isothiocyanate |
| ingilizce ad? |
4-Bromophenyl isothiocyanate; Isothiocaynic acid 4-bromophenyl ester; 4-(Isothiocyanato)-bromobenzene; 1-bromo-4-isothiocyanatobenzene |
| Moleküler Formülü |
C7H4BrNS |
| Molekül A??rl??? |
214.0824 |
| InChI |
InChI=1/C7H4BrNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| CAS kay?t numaras? |
1985-12-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.5g/cm3 |
| Ergime noktas? |
56-58℃ |
| Kaynama noktas? |
280.1°C at 760 mmHg |
| K?r?lma indisi |
1.622 |
| Alevlenme noktas? |
123.2°C |
| Buhar bas?nc? |
0.00656mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|