18031-40-8;2111-75-3 L(-)-Perillaldehyde
| ürün Ad? |
L(-)-Perillaldehyde |
| ingilizce ad? |
L(-)-Perillaldehyde; L-4(1-Methylethenyl)-1-cyclohexene-1-carboxaldehyde; (-)-Perillaaldehyde; 1-methoxy-2,3,5-trimethylbenzene; (4S)-4-(1-methylethenyl)cyclohex-1-ene-1-carbaldehyde; (-)-Perillaldehyde; L-perillaldehyde; ; 4-isopropenylcyclohex-1-enecarbaldehyde; 4-(prop-1-en-2-yl)cyclohex-1-ene-1-carbaldehyde; Perilla aldehyde |
| Moleküler Formülü |
C10H14O |
| Molekül A??rl??? |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,7,10H,1,4-6H2,2H3/t10-/m1/s1 |
| CAS kay?t numaras? |
18031-40-8;2111-75-3 |
| EINECS |
243-843-1;218-302-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.002g/cm3 |
| Kaynama noktas? |
238°C at 760 mmHg |
| K?r?lma indisi |
1.543 |
| Alevlenme noktas? |
95.6°C |
| Buhar bas?nc? |
0.0434mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|