ChemNet > CAS > 17639-76-8 Methyl 2-methoxypropionate
17639-76-8 Methyl 2-methoxypropionate
| ürün Ad? |
Methyl 2-methoxypropionate |
| ingilizce ad? |
Methyl 2-methoxypropionate; 2-Methoxypropionic acid methyl ester; methyl 2-methoxypropanoate |
| Moleküler Formülü |
C5H10O3 |
| Molekül A??rl??? |
118.1311 |
| InChI |
InChI=1/C5H10O3/c1-4(7-2)5(6)8-3/h4H,1-3H3 |
| CAS kay?t numaras? |
17639-76-8 |
| EINECS |
241-622-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.973g/cm3 |
| Kaynama noktas? |
136.2°C at 760 mmHg |
| K?r?lma indisi |
1.389 |
| Alevlenme noktas? |
40.6°C |
| Buhar bas?nc? |
7.45mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|