95-63-6 1,2,4-Trimethylbenzene
| ??? ?????? |
1,2,4-Trimethylbenzene |
| ????? ??????????? |
1,2,4-Trimethylbenzene; Pseudocumene; 1,2,4-Trimethylbenzere; 1,3,4-Trimethylbenzene |
| ?????? ???????? |
C9H12 |
| ????? ??????? ??????? |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| ?????????? ???????? ??????? |
95-63-6 |
| ???????? ????????? ??? |
202-436-9 |
| ???? ?????? |
|
| ????? |
0.88 |
| ???? ???????? |
-44℃ |
| ???? ??????? |
168℃ |
| ????? ???????? |
1.503-1.505 |
| ???? ?????? |
48℃ |
| ?????? ??? ??????? ?????? |
Xn:Harmful;
N:Dangerous for the environment;
|
| ??? ????????? |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|