541-50-4 Acetoacetic Acid
| ??? ?????? |
Acetoacetic Acid |
| ????? ??????????? |
Acetoacetic Acid; 3-Oxobutanoic acid |
| ?????? ???????? |
C4H6O3 |
| ????? ??????? ??????? |
102.0886 |
| InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
| ?????????? ???????? ??????? |
541-50-4 |
| ???? ?????? |
|
| ????? |
1.182g/cm3 |
| ???? ??????? |
237.7°C at 760 mmHg |
| ????? ???????? |
1.427 |
| ???? ?????? |
111.8°C |
| ??? ?????? |
0.015mmHg at 25°C |
| ??? ????????? |
R36/37:Irritating to eyes and respiratory system.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|