787-84-8 sym-Dibenzoylhydrazine
| Nome do produto |
sym-Dibenzoylhydrazine |
| Nome em inglês |
sym-Dibenzoylhydrazine; N,N-Dibenzoylhydrazine; NN-Dibenzoylhydrazine; N,N-Dibenzhydrazide; N'-benzoylbenzohydrazide; Dibenzoyl hydrazine (symmetrical) |
| Fórmula molecular |
C14H12N2O2 |
| Peso Molecular |
240.2573 |
| InChI |
InChI=1/C14H12N2O2/c17-13(11-7-3-1-4-8-11)15-16-14(18)12-9-5-2-6-10-12/h1-10H,(H,15,17)(H,16,18) |
| CAS Registry Number |
787-84-8 |
| EINECS |
212-329-9 |
| Estrutura Molecular |
|
| Densidade |
1.213g/cm3 |
| Ponto de fus?o |
238.5-240.5℃ |
| Ponto de ebuli??o |
485.6°C at 760 mmHg |
| índice de refra??o |
1.607 |
| O ponto de inflama??o |
202.8°C |
| Press?o de vapor |
1.39E-09mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|